C19H25ClFN3O2 — CID 25246880
1-[1-[(2-chloro-6-fluorophenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxamide (PubChem CID 25246880) has the molecular formula C19H25ClFN3O2 and a molecular weight of 381.88 g/mol. Its IUPAC name is 1-[1-[(2-chloro-6-fluorophenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 25246880 |
| Molecular Formula | C19H25ClFN3O2 |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-[1-[(2-chloro-6-fluorophenyl)methyl]piperidine-4-carbonyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)C2CCN(Cc3c(F)cccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C19H25ClFN3O2/c20-16-2-1-3-17(21)15(16)12-23-8-4-14(5-9-23)19(26)24-10-6-13(7-11-24)18(22)25/h1-3,13-14H,4-12H2,(H2,22,25) |
| InChIKey | VCXXSHVWVABEAC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |