C22H19Cl2NO3 — CID 27108948
4-[[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylazaniumyl]methyl]benzoate (PubChem CID 27108948) has the molecular formula C22H19Cl2NO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is 4-[[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylazaniumyl]methyl]benzoate.
| Compound Name | 4-[[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylazaniumyl]methyl]benzoate |
|---|---|
| PubChem CID | 27108948 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | 4-[[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylazaniumyl]methyl]benzoate |
| SMILES | O=C([O-])c1ccc(C[NH2+]Cc2cccc(OCc3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C22H19Cl2NO3/c23-19-9-8-18(21(24)11-19)14-28-20-3-1-2-16(10-20)13-25-12-15-4-6-17(7-5-15)22(26)27/h1-11,25H,12-14H2,(H,26,27) |
| InChIKey | XZIQUMGHKWQCJG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |