C14H15Cl2N7O2 — CID 98340587
(3E)-N-[[1-amino-2-(1,2,4-triazol-1-yl)ethylidene]amino]-3-[(2,4-dichlorophenyl)methoxyimino]propanamide (PubChem CID 98340587) has the molecular formula C14H15Cl2N7O2 and a molecular weight of 384.23 g/mol. Its IUPAC name is (3E)-N-[[1-amino-2-(1,2,4-triazol-1-yl)ethylidene]amino]-3-[(2,4-dichlorophenyl)methoxyimino]propanamide.
| Compound Name | (3E)-N-[[1-amino-2-(1,2,4-triazol-1-yl)ethylidene]amino]-3-[(2,4-dichlorophenyl)methoxyimino]propanamide |
|---|---|
| PubChem CID | 98340587 |
| Molecular Formula | C14H15Cl2N7O2 |
| Molecular Weight | 384.23 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | (3E)-N-[[1-amino-2-(1,2,4-triazol-1-yl)ethylidene]amino]-3-[(2,4-dichlorophenyl)methoxyimino]propanamide |
| SMILES | NC(Cn1cncn1)=NNC(=O)C/C=N/OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2N7O2/c15-11-2-1-10(12(16)5-11)7-25-20-4-3-14(24)22-21-13(17)6-23-9-18-8-19-23/h1-2,4-5,8-9H,3,6-7H2,(H2,17,21)(H,22,24)/b20-4+ |
| InChIKey | TUGJBHAKYLNYQZ-LRNAUUFOSA-N |
| XLogP | 1.57 |
| TPSA | 119.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|