C11H12Cl3N5O — CID 131632842
N'-[(2,4-dichlorophenyl)methoxy]-2-(1,2,4-triazol-1-yl)ethanimidamide;hydrochloride (PubChem CID 131632842) has the molecular formula C11H12Cl3N5O and a molecular weight of 336.61 g/mol. Its IUPAC name is N'-[(2,4-dichlorophenyl)methoxy]-2-(1,2,4-triazol-1-yl)ethanimidamide;hydrochloride.
| Compound Name | N'-[(2,4-dichlorophenyl)methoxy]-2-(1,2,4-triazol-1-yl)ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 131632842 |
| Molecular Formula | C11H12Cl3N5O |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | N'-[(2,4-dichlorophenyl)methoxy]-2-(1,2,4-triazol-1-yl)ethanimidamide;hydrochloride |
| SMILES | Cl.NC(Cn1cncn1)=NOCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N5O.ClH/c12-9-2-1-8(10(13)3-9)5-19-17-11(14)4-18-7-15-6-16-18;/h1-3,6-7H,4-5H2,(H2,14,17);1H |
| InChIKey | ZZCPKTWOEBBUCH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|