C18H16Cl4N4O4 — CID 159230946
azonic acid;1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine (PubChem CID 159230946) has the molecular formula C18H16Cl4N4O4 and a molecular weight of 494.16 g/mol. Its IUPAC name is azonic acid;1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine.
| Compound Name | azonic acid;1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine |
|---|---|
| PubChem CID | 159230946 |
| Molecular Formula | C18H16Cl4N4O4 |
| Molecular Weight | 494.16 g/mol |
| Exact Mass | 491.99 |
| IUPAC Name | azonic acid;1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine |
| SMILES | Clc1ccc(CON=C(Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1.[O-][NH+](O)O |
| InChI | InChI=1S/C18H13Cl4N3O.H3NO3/c19-13-2-1-12(16(21)7-13)10-26-24-18(9-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22;2-1(3)4/h1-8,11H,9-10H2;1-3H |
| InChIKey | KSWSZRZOFWFTQG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.16 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|