C14H13Cl2N3O — CID 141174032
1-(2,4-dichlorophenyl)-2-imidazol-1-yl-N-prop-1-enoxyethanimine (PubChem CID 141174032) has the molecular formula C14H13Cl2N3O and a molecular weight of 310.18 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-imidazol-1-yl-N-prop-1-enoxyethanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-2-imidazol-1-yl-N-prop-1-enoxyethanimine |
|---|---|
| PubChem CID | 141174032 |
| Molecular Formula | C14H13Cl2N3O |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-imidazol-1-yl-N-prop-1-enoxyethanimine |
| SMILES | CC=CON=C(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H13Cl2N3O/c1-2-7-20-18-14(9-19-6-5-17-10-19)12-4-3-11(15)8-13(12)16/h2-8,10H,9H2,1H3 |
| InChIKey | ULARJJCDJHCYQX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|