C12H14Cl2N2Si — CID 13392416
(2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane (PubChem CID 13392416) has the molecular formula C12H14Cl2N2Si and a molecular weight of 285.25 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane.
| Compound Name | (2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane |
|---|---|
| PubChem CID | 13392416 |
| Molecular Formula | C12H14Cl2N2Si |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | (2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-dimethylsilane |
| SMILES | C[Si](C)(Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N2Si/c1-17(2,9-16-6-5-15-8-16)12-4-3-10(13)7-11(12)14/h3-8H,9H2,1-2H3 |
| InChIKey | SWTJWBFIVRJAKX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|