C17H14Cl4N2Si — CID 13392449
bis(2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-methylsilane (PubChem CID 13392449) has the molecular formula C17H14Cl4N2Si and a molecular weight of 416.21 g/mol. Its IUPAC name is bis(2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-methylsilane.
| Compound Name | bis(2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-methylsilane |
|---|---|
| PubChem CID | 13392449 |
| Molecular Formula | C17H14Cl4N2Si |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | bis(2,4-dichlorophenyl)-(imidazol-1-ylmethyl)-methylsilane |
| SMILES | C[Si](Cn1ccnc1)(c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl4N2Si/c1-24(11-23-7-6-22-10-23,16-4-2-12(18)8-14(16)20)17-5-3-13(19)9-15(17)21/h2-10H,11H2,1H3 |
| InChIKey | UYCRZJCNDDMRSL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|