C20H18Cl4N2O2 — CID 70500879
1-[(E)-2,3-bis(2,4-dichlorophenyl)prop-2-enyl]imidazole;ethane-1,2-diol (PubChem CID 70500879) has the molecular formula C20H18Cl4N2O2 and a molecular weight of 460.19 g/mol. Its IUPAC name is 1-[(E)-2,3-bis(2,4-dichlorophenyl)prop-2-enyl]imidazole;ethane-1,2-diol.
| Compound Name | 1-[(E)-2,3-bis(2,4-dichlorophenyl)prop-2-enyl]imidazole;ethane-1,2-diol |
|---|---|
| PubChem CID | 70500879 |
| Molecular Formula | C20H18Cl4N2O2 |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 1-[(E)-2,3-bis(2,4-dichlorophenyl)prop-2-enyl]imidazole;ethane-1,2-diol |
| SMILES | Clc1ccc(/C=C(/Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1.OCCO |
| InChI | InChI=1S/C18H12Cl4N2.C2H6O2/c19-14-2-1-12(17(21)8-14)7-13(10-24-6-5-23-11-24)16-4-3-15(20)9-18(16)22;3-1-2-4/h1-9,11H,10H2;3-4H,1-2H2/b13-7-; |
| InChIKey | GTFZLONUIXBRGN-QCCGTXRUSA-N |
| XLogP | 5.71 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|