C40H30Cl4N4O6 — CID 57052475
bis[2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-3-imidazol-1-ylprop-1-enyl] oxalate (PubChem CID 57052475) has the molecular formula C40H30Cl4N4O6 and a molecular weight of 804.51 g/mol. Its IUPAC name is bis[2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-3-imidazol-1-ylprop-1-enyl] oxalate.
| Compound Name | bis[2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-3-imidazol-1-ylprop-1-enyl] oxalate |
|---|---|
| PubChem CID | 57052475 |
| Molecular Formula | C40H30Cl4N4O6 |
| Molecular Weight | 804.51 g/mol |
| Exact Mass | 802.09 |
| IUPAC Name | bis[2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]-3-imidazol-1-ylprop-1-enyl] oxalate |
| SMILES | O=C(OC=C(Cn1ccnc1)c1ccccc1OCc1ccc(Cl)cc1Cl)C(=O)OC=C(Cn1ccnc1)c1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C40H30Cl4N4O6/c41-31-11-9-27(35(43)17-31)21-51-37-7-3-1-5-33(37)29(19-47-15-13-45-25-47)23-53-39(49)40(50)54-24-30(20-48-16-14-46-26-48)34-6-2-4-8-38(34)52-22-28-10-12-32(42)18-36(28)44/h1-18,23-26H,19-22H2 |
| InChIKey | QAKKTGRIKKAUBW-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 106.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.51 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|