C20H17Cl4N3O3 — CID 129184950
acetic acid;(Z)-1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine (PubChem CID 129184950) has the molecular formula C20H17Cl4N3O3 and a molecular weight of 489.19 g/mol. Its IUPAC name is acetic acid;(Z)-1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine.
| Compound Name | acetic acid;(Z)-1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine |
|---|---|
| PubChem CID | 129184950 |
| Molecular Formula | C20H17Cl4N3O3 |
| Molecular Weight | 489.19 g/mol |
| Exact Mass | 487.00 |
| IUPAC Name | acetic acid;(Z)-1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-imidazol-1-ylethanimine |
| SMILES | CC(=O)O.Clc1ccc(CO/N=C(\Cn2ccnc2)c2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl4N3O.C2H4O2/c19-13-2-1-12(16(21)7-13)10-26-24-18(9-25-6-5-23-11-25)15-4-3-14(20)8-17(15)22;1-2(3)4/h1-8,11H,9-10H2;1H3,(H,3,4)/b24-18+; |
| InChIKey | YIDZYYYPXGEHHV-NDUABGMUSA-N |
| XLogP | 6.21 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.19 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|