C19H18Cl2N2O5S — CID 14062132
1-[2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enyl]imidazole;sulfuric acid (PubChem CID 14062132) has the molecular formula C19H18Cl2N2O5S and a molecular weight of 457.34 g/mol. Its IUPAC name is 1-[2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enyl]imidazole;sulfuric acid.
| Compound Name | 1-[2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enyl]imidazole;sulfuric acid |
|---|---|
| PubChem CID | 14062132 |
| Molecular Formula | C19H18Cl2N2O5S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 1-[2-[2-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enyl]imidazole;sulfuric acid |
| SMILES | C=C(Cn1ccnc1)c1ccccc1OCc1ccc(Cl)cc1Cl.O=S(=O)(O)O |
| InChI | InChI=1S/C19H16Cl2N2O.H2O4S/c1-14(11-23-9-8-22-13-23)17-4-2-3-5-19(17)24-12-15-6-7-16(20)10-18(15)21;1-5(2,3)4/h2-10,13H,1,11-12H2;(H2,1,2,3,4) |
| InChIKey | NMPRPNBLONFONN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|