C17H12Cl4N4O — CID 54420429
1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-(1,2,4-triazol-1-yl)ethanimine (PubChem CID 54420429) has the molecular formula C17H12Cl4N4O and a molecular weight of 430.12 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-(1,2,4-triazol-1-yl)ethanimine.
| Compound Name | 1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-(1,2,4-triazol-1-yl)ethanimine |
|---|---|
| PubChem CID | 54420429 |
| Molecular Formula | C17H12Cl4N4O |
| Molecular Weight | 430.12 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-[(2,4-dichlorophenyl)methoxy]-2-(1,2,4-triazol-1-yl)ethanimine |
| SMILES | Clc1ccc(CON=C(Cn2cncn2)c2ccc(Cl)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl4N4O/c18-12-2-1-11(15(20)5-12)8-26-24-17(7-25-10-22-9-23-25)14-4-3-13(19)6-16(14)21/h1-6,9-10H,7-8H2 |
| InChIKey | WAKSGLQGVFUDGY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.12 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|