C11H12Cl3N5O — CID 2766524
[1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-[(2,4-dichlorophenyl)methoxy]azanium chloride (PubChem CID 2766524) has the molecular formula C11H12Cl3N5O and a molecular weight of 336.61 g/mol. Its IUPAC name is [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-[(2,4-dichlorophenyl)methoxy]azanium chloride.
| Compound Name | [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-[(2,4-dichlorophenyl)methoxy]azanium chloride |
|---|---|
| PubChem CID | 2766524 |
| Molecular Formula | C11H12Cl3N5O |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-[(2,4-dichlorophenyl)methoxy]azanium chloride |
| SMILES | NC(Cn1cncn1)=[NH+]OCc1ccc(Cl)cc1Cl.[Cl-] |
| InChI | InChI=1S/C11H11Cl2N5O.ClH/c12-9-2-1-8(10(13)3-9)5-19-17-11(14)4-18-7-15-6-16-18;/h1-3,6-7H,4-5H2,(H2,14,17);1H |
| InChIKey | ZZCPKTWOEBBUCH-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|