C4H8ClN5O — CID 137238686
[1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-hydroxyazanium chloride (PubChem CID 137238686) has the molecular formula C4H8ClN5O and a molecular weight of 177.60 g/mol. Its IUPAC name is [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-hydroxyazanium chloride.
| Compound Name | [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-hydroxyazanium chloride |
|---|---|
| PubChem CID | 137238686 |
| Molecular Formula | C4H8ClN5O |
| Molecular Weight | 177.60 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-hydroxyazanium chloride |
| SMILES | NC(Cn1cncn1)=[NH+]O.[Cl-] |
| InChI | InChI=1S/C4H7N5O.ClH/c5-4(8-10)1-9-3-6-2-7-9;/h2-3,10H,1H2,(H2,5,8);1H |
| InChIKey | GLJLLLOIMJXTCM-UHFFFAOYSA-N |
| XLogP | -5.89 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.60 |
| LogP ≤ 5 | -5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|