C9H17N6O3+ — CID 7043190
[1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-(3,3-dimethoxypropanoylamino)azanium (PubChem CID 7043190) has the molecular formula C9H17N6O3+ and a molecular weight of 257.27 g/mol. Its IUPAC name is [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-(3,3-dimethoxypropanoylamino)azanium.
| Compound Name | [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-(3,3-dimethoxypropanoylamino)azanium |
|---|---|
| PubChem CID | 7043190 |
| Molecular Formula | C9H17N6O3+ |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | [1-amino-2-(1,2,4-triazol-1-yl)ethylidene]-(3,3-dimethoxypropanoylamino)azanium |
| SMILES | COC(CC(=O)N[NH+]=C(N)Cn1cncn1)OC |
| InChI | InChI=1S/C9H16N6O3/c1-17-9(18-2)3-8(16)14-13-7(10)4-15-6-11-5-12-15/h5-6,9H,3-4H2,1-2H3,(H2,10,13)(H,14,16)/p+1 |
| InChIKey | DRVGHHPUDKGVSD-UHFFFAOYSA-O |
| XLogP | -3.24 |
| TPSA | 118.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|