C4H7N5O — CID 6285578
N'-hydroxy-2-(1,2,4-triazol-1-yl)ethanimidamide (PubChem CID 6285578) has the molecular formula C4H7N5O and a molecular weight of 141.13 g/mol. Its IUPAC name is N'-hydroxy-2-(1,2,4-triazol-1-yl)ethanimidamide.
| Compound Name | N'-hydroxy-2-(1,2,4-triazol-1-yl)ethanimidamide |
|---|---|
| PubChem CID | 6285578 |
| Molecular Formula | C4H7N5O |
| Molecular Weight | 141.13 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | N'-hydroxy-2-(1,2,4-triazol-1-yl)ethanimidamide |
| SMILES | N/C(Cn1cncn1)=N\O |
| InChI | InChI=1S/C4H7N5O/c5-4(8-10)1-9-3-6-2-7-9/h2-3,10H,1H2,(H2,5,8) |
| InChIKey | XIVWQXRPIVXZRZ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.13 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|