C8H13FN4O — CID 88748640
(NE)-N-[4-fluoro-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine (PubChem CID 88748640) has the molecular formula C8H13FN4O and a molecular weight of 200.22 g/mol. Its IUPAC name is (NE)-N-[4-fluoro-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[4-fluoro-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 88748640 |
| Molecular Formula | C8H13FN4O |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | (NE)-N-[4-fluoro-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine |
| SMILES | CC(C)(CF)/C(Cn1cncn1)=N\O |
| InChI | InChI=1S/C8H13FN4O/c1-8(2,4-9)7(12-14)3-13-6-10-5-11-13/h5-6,14H,3-4H2,1-2H3/b12-7- |
| InChIKey | BZJMRBBECBDOPY-GHXNOFRVSA-N |
| XLogP | 1.10 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|