C9H16N4OS — CID 88747139
(NE)-N-[3,3-dimethyl-4-methylsulfanyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine (PubChem CID 88747139) has the molecular formula C9H16N4OS and a molecular weight of 228.32 g/mol. Its IUPAC name is (NE)-N-[3,3-dimethyl-4-methylsulfanyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine.
| Compound Name | (NE)-N-[3,3-dimethyl-4-methylsulfanyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 88747139 |
| Molecular Formula | C9H16N4OS |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (NE)-N-[3,3-dimethyl-4-methylsulfanyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]hydroxylamine |
| SMILES | CSCC(C)(C)/C(Cn1cncn1)=N\O |
| InChI | InChI=1S/C9H16N4OS/c1-9(2,5-15-3)8(12-14)4-13-7-10-6-11-13/h6-7,14H,4-5H2,1-3H3/b12-8- |
| InChIKey | IUYSZKNWBGJZJW-WQLSENKSSA-N |
| XLogP | 1.50 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|