C10H16N4 — CID 23574302
1-(2-isocyano-2,3,3-trimethylbutyl)-1,2,4-triazole (PubChem CID 23574302) has the molecular formula C10H16N4 and a molecular weight of 192.27 g/mol. Its IUPAC name is 1-(2-isocyano-2,3,3-trimethylbutyl)-1,2,4-triazole.
| Compound Name | 1-(2-isocyano-2,3,3-trimethylbutyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 23574302 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1-(2-isocyano-2,3,3-trimethylbutyl)-1,2,4-triazole |
| SMILES | [C-]#[N+]C(C)(Cn1cncn1)C(C)(C)C |
| InChI | InChI=1S/C10H16N4/c1-9(2,3)10(4,11-5)6-14-8-12-7-13-14/h7-8H,6H2,1-4H3 |
| InChIKey | VGJJPQCSFWUROM-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|