C11H18N6OS — CID 19870499
3,3-dimethyl-4-sulfanyl-1-(1,2,4-triazol-1-yl)-2-(1,2,4-triazol-1-ylmethyl)butan-2-ol (PubChem CID 19870499) has the molecular formula C11H18N6OS and a molecular weight of 282.37 g/mol. Its IUPAC name is 3,3-dimethyl-4-sulfanyl-1-(1,2,4-triazol-1-yl)-2-(1,2,4-triazol-1-ylmethyl)butan-2-ol.
| Compound Name | 3,3-dimethyl-4-sulfanyl-1-(1,2,4-triazol-1-yl)-2-(1,2,4-triazol-1-ylmethyl)butan-2-ol |
|---|---|
| PubChem CID | 19870499 |
| Molecular Formula | C11H18N6OS |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 3,3-dimethyl-4-sulfanyl-1-(1,2,4-triazol-1-yl)-2-(1,2,4-triazol-1-ylmethyl)butan-2-ol |
| SMILES | CC(C)(CS)C(O)(Cn1cncn1)Cn1cncn1 |
| InChI | InChI=1S/C11H18N6OS/c1-10(2,5-19)11(18,3-16-8-12-6-14-16)4-17-9-13-7-15-17/h6-9,18-19H,3-5H2,1-2H3 |
| InChIKey | XXBMGCGYPQKZNE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|