C14H25N3O — CID 67695211
4-(1,2,4-triazol-1-ylmethyl)undec-1-en-4-ol (PubChem CID 67695211) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-ylmethyl)undec-1-en-4-ol.
| Compound Name | 4-(1,2,4-triazol-1-ylmethyl)undec-1-en-4-ol |
|---|---|
| PubChem CID | 67695211 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 4-(1,2,4-triazol-1-ylmethyl)undec-1-en-4-ol |
| SMILES | C=CCC(O)(CCCCCCC)Cn1cncn1 |
| InChI | InChI=1S/C14H25N3O/c1-3-5-6-7-8-10-14(18,9-4-2)11-17-13-15-12-16-17/h4,12-13,18H,2-3,5-11H2,1H3 |
| InChIKey | SQXTWWBETLXGBR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|