C12H19N3O — CID 123787959
1-(2-ethoxy-2,3-dimethylhexa-3,5-dienyl)-1,2,4-triazole (PubChem CID 123787959) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(2-ethoxy-2,3-dimethylhexa-3,5-dienyl)-1,2,4-triazole.
| Compound Name | 1-(2-ethoxy-2,3-dimethylhexa-3,5-dienyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 123787959 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 1-(2-ethoxy-2,3-dimethylhexa-3,5-dienyl)-1,2,4-triazole |
| SMILES | C=CC=C(C)C(C)(Cn1cncn1)OCC |
| InChI | InChI=1S/C12H19N3O/c1-5-7-11(3)12(4,16-6-2)8-15-10-13-9-14-15/h5,7,9-10H,1,6,8H2,2-4H3 |
| InChIKey | GHNGFZVZXCLRMA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|