C13H20ClN3O3 — CID 156631901
ethyl 3-(1-chlorocyclopropyl)-3-hydroxy-2,2-dimethyl-4-(1,2,4-triazol-1-yl)butanoate (PubChem CID 156631901) has the molecular formula C13H20ClN3O3 and a molecular weight of 301.77 g/mol. Its IUPAC name is ethyl 3-(1-chlorocyclopropyl)-3-hydroxy-2,2-dimethyl-4-(1,2,4-triazol-1-yl)butanoate.
| Compound Name | ethyl 3-(1-chlorocyclopropyl)-3-hydroxy-2,2-dimethyl-4-(1,2,4-triazol-1-yl)butanoate |
|---|---|
| PubChem CID | 156631901 |
| Molecular Formula | C13H20ClN3O3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | ethyl 3-(1-chlorocyclopropyl)-3-hydroxy-2,2-dimethyl-4-(1,2,4-triazol-1-yl)butanoate |
| SMILES | CCOC(=O)C(C)(C)C(O)(Cn1cncn1)C1(Cl)CC1 |
| InChI | InChI=1S/C13H20ClN3O3/c1-4-20-10(18)11(2,3)13(19,12(14)5-6-12)7-17-9-15-8-16-17/h8-9,19H,4-7H2,1-3H3 |
| InChIKey | DLAVTBZMGYNFGS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|