C12H16Cl3N3O — CID 71112963
2-(1-chlorocyclopropyl)-3-(2,2-dichlorocyclopropyl)-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 71112963) has the molecular formula C12H16Cl3N3O and a molecular weight of 324.64 g/mol. Its IUPAC name is 2-(1-chlorocyclopropyl)-3-(2,2-dichlorocyclopropyl)-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 2-(1-chlorocyclopropyl)-3-(2,2-dichlorocyclopropyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 71112963 |
| Molecular Formula | C12H16Cl3N3O |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 2-(1-chlorocyclopropyl)-3-(2,2-dichlorocyclopropyl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC(C1CC1(Cl)Cl)C(O)(Cn1cncn1)C1(Cl)CC1 |
| InChI | InChI=1S/C12H16Cl3N3O/c1-8(9-4-12(9,14)15)11(19,10(13)2-3-10)5-18-7-16-6-17-18/h6-9,19H,2-5H2,1H3 |
| InChIKey | IVESSNIZFPNYFG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|