C10H12ClN3O — CID 15022048
2-(1-chlorocyclopropyl)-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol (PubChem CID 15022048) has the molecular formula C10H12ClN3O and a molecular weight of 225.68 g/mol. Its IUPAC name is 2-(1-chlorocyclopropyl)-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol.
| Compound Name | 2-(1-chlorocyclopropyl)-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol |
|---|---|
| PubChem CID | 15022048 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 2-(1-chlorocyclopropyl)-1-(1,2,4-triazol-1-yl)pent-4-yn-2-ol |
| SMILES | C#CCC(O)(Cn1cncn1)C1(Cl)CC1 |
| InChI | InChI=1S/C10H12ClN3O/c1-2-3-10(15,9(11)4-5-9)6-14-8-12-7-13-14/h1,7-8,15H,3-6H2 |
| InChIKey | ZXGFCCBZEOEBDJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|