C11H12ClN3O2 — CID 71322817
2-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol (PubChem CID 71322817) has the molecular formula C11H12ClN3O2 and a molecular weight of 253.69 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol.
| Compound Name | 2-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 71322817 |
| Molecular Formula | C11H12ClN3O2 |
| Molecular Weight | 253.69 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-(2-chlorophenyl)-3-(1,2,4-triazol-1-yl)propane-1,2-diol |
| SMILES | OCC(O)(Cn1cncn1)c1ccccc1Cl |
| InChI | InChI=1S/C11H12ClN3O2/c12-10-4-2-1-3-9(10)11(17,6-16)5-15-8-13-7-14-15/h1-4,7-8,16-17H,5-6H2 |
| InChIKey | QHDAWWCSSVKVRL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.69 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |