C11H10Cl2N6O — CID 14706518
1-azido-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 14706518) has the molecular formula C11H10Cl2N6O and a molecular weight of 313.15 g/mol. Its IUPAC name is 1-azido-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 1-azido-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 14706518 |
| Molecular Formula | C11H10Cl2N6O |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 1-azido-2-(2,4-dichlorophenyl)-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | [N-]=[N+]=NCC(O)(Cn1cncn1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H10Cl2N6O/c12-8-1-2-9(10(13)3-8)11(20,4-16-18-14)5-19-7-15-6-17-19/h1-3,6-7,20H,4-5H2 |
| InChIKey | MOCRNQHOIFZSLE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 99.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|