C20H25Cl2N3O7 — CID 171040304
(2R,3R,4S,5S,6R)-2-[3-chloro-4-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 171040304) has the molecular formula C20H25Cl2N3O7 and a molecular weight of 490.34 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[3-chloro-4-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[3-chloro-4-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 171040304 |
| Molecular Formula | C20H25Cl2N3O7 |
| Molecular Weight | 490.34 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[3-chloro-4-[2-(1-chlorocyclopropyl)-2-hydroxy-3-(1,2,4-triazol-1-yl)propyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@H](Oc2ccc(CC(O)(Cn3cncn3)C3(Cl)CC3)c(Cl)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H25Cl2N3O7/c21-13-5-12(31-18-17(29)16(28)15(27)14(7-26)32-18)2-1-11(13)6-20(30,19(22)3-4-19)8-25-10-23-9-24-25/h1-2,5,9-10,14-18,26-30H,3-4,6-8H2/t14-,15-,16+,17-,18+,20?/m1/s1 |
| InChIKey | UOSFBRWNUDUTNU-OLGPWVGZSA-N |
| XLogP | -0.14 |
| TPSA | 150.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|