C13H17NO7 — CID 91934179
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(nitrosomethyl)phenoxy]oxane-3,4,5-triol (PubChem CID 91934179) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(nitrosomethyl)phenoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(nitrosomethyl)phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 91934179 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-(nitrosomethyl)phenoxy]oxane-3,4,5-triol |
| SMILES | O=NCc1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C13H17NO7/c15-6-9-10(16)11(17)12(18)13(21-9)20-8-3-1-7(2-4-8)5-14-19/h1-4,9-13,15-18H,5-6H2/t9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | MJOCVWJPMJBVIQ-SYLRKERUSA-N |
| XLogP | -0.87 |
| TPSA | 128.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |