C12H16Cl3N3 — CID 174975377
1-[4-(1-chlorocyclopropyl)-4-[(1S)-2,2-dichlorocyclopropyl]butyl]-1,2,4-triazole (PubChem CID 174975377) has the molecular formula C12H16Cl3N3 and a molecular weight of 308.64 g/mol. Its IUPAC name is 1-[4-(1-chlorocyclopropyl)-4-[(1S)-2,2-dichlorocyclopropyl]butyl]-1,2,4-triazole.
| Compound Name | 1-[4-(1-chlorocyclopropyl)-4-[(1S)-2,2-dichlorocyclopropyl]butyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 174975377 |
| Molecular Formula | C12H16Cl3N3 |
| Molecular Weight | 308.64 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | 1-[4-(1-chlorocyclopropyl)-4-[(1S)-2,2-dichlorocyclopropyl]butyl]-1,2,4-triazole |
| SMILES | ClC1(C(CCCn2cncn2)[C@@H]2CC2(Cl)Cl)CC1 |
| InChI | InChI=1S/C12H16Cl3N3/c13-11(3-4-11)9(10-6-12(10,14)15)2-1-5-18-8-16-7-17-18/h7-10H,1-6H2/t9?,10-/m0/s1 |
| InChIKey | XTBGKVZBKAMAPL-AXDSSHIGSA-N |
| XLogP | 3.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|