C19H23F4N3O4 — CID 139793211
ethyl 5-(2,4-difluorophenyl)-4,4-difluoro-3,5-dihydroxy-2,2,3-trimethyl-6-(1,2,4-triazol-1-yl)hexanoate (PubChem CID 139793211) has the molecular formula C19H23F4N3O4 and a molecular weight of 433.40 g/mol. Its IUPAC name is ethyl 5-(2,4-difluorophenyl)-4,4-difluoro-3,5-dihydroxy-2,2,3-trimethyl-6-(1,2,4-triazol-1-yl)hexanoate.
| Compound Name | ethyl 5-(2,4-difluorophenyl)-4,4-difluoro-3,5-dihydroxy-2,2,3-trimethyl-6-(1,2,4-triazol-1-yl)hexanoate |
|---|---|
| PubChem CID | 139793211 |
| Molecular Formula | C19H23F4N3O4 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | ethyl 5-(2,4-difluorophenyl)-4,4-difluoro-3,5-dihydroxy-2,2,3-trimethyl-6-(1,2,4-triazol-1-yl)hexanoate |
| SMILES | CCOC(=O)C(C)(C)C(C)(O)C(F)(F)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H23F4N3O4/c1-5-30-15(27)16(2,3)17(4,28)19(22,23)18(29,9-26-11-24-10-25-26)13-7-6-12(20)8-14(13)21/h6-8,10-11,28-29H,5,9H2,1-4H3 |
| InChIKey | KNUPAFWGZLSCTN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |