C14H17F2N3OS — CID 139619155
2-(2,4-difluorophenyl)-3,3-dimethyl-4-sulfanyl-1-(1,2,4-triazol-1-yl)butan-2-ol (PubChem CID 139619155) has the molecular formula C14H17F2N3OS and a molecular weight of 313.37 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-3,3-dimethyl-4-sulfanyl-1-(1,2,4-triazol-1-yl)butan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-3,3-dimethyl-4-sulfanyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 139619155 |
| Molecular Formula | C14H17F2N3OS |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2-(2,4-difluorophenyl)-3,3-dimethyl-4-sulfanyl-1-(1,2,4-triazol-1-yl)butan-2-ol |
| SMILES | CC(C)(CS)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H17F2N3OS/c1-13(2,7-21)14(20,6-19-9-17-8-18-19)11-4-3-10(15)5-12(11)16/h3-5,8-9,20-21H,6-7H2,1-2H3 |
| InChIKey | AQHDRWMXUUZWHX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|