C14H12F7N3O2 — CID 23324898
2-(2,4-difluorophenyl)-4,4,5,5,5-pentafluoro-3-methyl-1-(1,2,4-triazol-1-yl)pentane-2,3-diol (PubChem CID 23324898) has the molecular formula C14H12F7N3O2 and a molecular weight of 387.26 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-4,4,5,5,5-pentafluoro-3-methyl-1-(1,2,4-triazol-1-yl)pentane-2,3-diol.
| Compound Name | 2-(2,4-difluorophenyl)-4,4,5,5,5-pentafluoro-3-methyl-1-(1,2,4-triazol-1-yl)pentane-2,3-diol |
|---|---|
| PubChem CID | 23324898 |
| Molecular Formula | C14H12F7N3O2 |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 2-(2,4-difluorophenyl)-4,4,5,5,5-pentafluoro-3-methyl-1-(1,2,4-triazol-1-yl)pentane-2,3-diol |
| SMILES | CC(O)(C(O)(Cn1cncn1)c1ccc(F)cc1F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H12F7N3O2/c1-11(25,13(17,18)14(19,20)21)12(26,5-24-7-22-6-23-24)9-3-2-8(15)4-10(9)16/h2-4,6-7,25-26H,5H2,1H3 |
| InChIKey | YATJFQUEPQZNKM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|