C20H29F2N3O2S — CID 10549678
7-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanylheptan-1-ol (PubChem CID 10549678) has the molecular formula C20H29F2N3O2S and a molecular weight of 413.53 g/mol. Its IUPAC name is 7-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanylheptan-1-ol.
| Compound Name | 7-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanylheptan-1-ol |
|---|---|
| PubChem CID | 10549678 |
| Molecular Formula | C20H29F2N3O2S |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 7-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(1,2,4-triazol-1-yl)butan-2-yl]sulfanylheptan-1-ol |
| SMILES | CC(C)(SCCCCCCCO)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H29F2N3O2S/c1-19(2,28-11-7-5-3-4-6-10-26)20(27,13-25-15-23-14-24-25)17-9-8-16(21)12-18(17)22/h8-9,12,14-15,26-27H,3-7,10-11,13H2,1-2H3 |
| InChIKey | MSQFKQBVVGAOSD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|