C12H11F4N5O2 — CID 19973099
3-(2,4-difluorophenyl)-2,2-difluoro-3-hydroxy-4-(1,2,4-triazol-1-yl)butanehydrazide (PubChem CID 19973099) has the molecular formula C12H11F4N5O2 and a molecular weight of 333.25 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-2,2-difluoro-3-hydroxy-4-(1,2,4-triazol-1-yl)butanehydrazide.
| Compound Name | 3-(2,4-difluorophenyl)-2,2-difluoro-3-hydroxy-4-(1,2,4-triazol-1-yl)butanehydrazide |
|---|---|
| PubChem CID | 19973099 |
| Molecular Formula | C12H11F4N5O2 |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-(2,4-difluorophenyl)-2,2-difluoro-3-hydroxy-4-(1,2,4-triazol-1-yl)butanehydrazide |
| SMILES | NNC(=O)C(F)(F)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H11F4N5O2/c13-7-1-2-8(9(14)3-7)11(23,4-21-6-18-5-19-21)12(15,16)10(22)20-17/h1-3,5-6,23H,4,17H2,(H,20,22) |
| InChIKey | QYYIKPWOYQYKQK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|