C21H25Cl2N3O — CID 139633662
(Z)-1-(2,4-dichlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-imidazol-1-ylethanimine (PubChem CID 139633662) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is (Z)-1-(2,4-dichlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-imidazol-1-ylethanimine.
| Compound Name | (Z)-1-(2,4-dichlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-imidazol-1-ylethanimine |
|---|---|
| PubChem CID | 139633662 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | (Z)-1-(2,4-dichlorophenyl)-N-[(2E)-3,7-dimethylocta-2,6-dienoxy]-2-imidazol-1-ylethanimine |
| SMILES | CC(C)=CCC/C(C)=C/CO/N=C(\Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H25Cl2N3O/c1-16(2)5-4-6-17(3)9-12-27-25-21(14-26-11-10-24-15-26)19-8-7-18(22)13-20(19)23/h5,7-11,13,15H,4,6,12,14H2,1-3H3/b17-9+,25-21+ |
| InChIKey | CAWHDHUENRDMHU-KPQQKVHQSA-N |
| XLogP | 6.30 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|