C13H12Cl2N2OS — CID 70583033
[2-(2,4-dichlorophenyl)-3-imidazol-1-ylprop-2-enyl]sulfanylmethanol (PubChem CID 70583033) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-3-imidazol-1-ylprop-2-enyl]sulfanylmethanol.
| Compound Name | [2-(2,4-dichlorophenyl)-3-imidazol-1-ylprop-2-enyl]sulfanylmethanol |
|---|---|
| PubChem CID | 70583033 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-3-imidazol-1-ylprop-2-enyl]sulfanylmethanol |
| SMILES | OCSCC(=Cn1ccnc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H12Cl2N2OS/c14-11-1-2-12(13(15)5-11)10(7-19-9-18)6-17-4-3-16-8-17/h1-6,8,18H,7,9H2 |
| InChIKey | DQZJSTNRZZQVGA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|