C18H13Cl3N2O2 — CID 54027975
1-[2-[(2-chlorophenoxy)methoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole (PubChem CID 54027975) has the molecular formula C18H13Cl3N2O2 and a molecular weight of 395.67 g/mol. Its IUPAC name is 1-[2-[(2-chlorophenoxy)methoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole.
| Compound Name | 1-[2-[(2-chlorophenoxy)methoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole |
|---|---|
| PubChem CID | 54027975 |
| Molecular Formula | C18H13Cl3N2O2 |
| Molecular Weight | 395.67 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | 1-[2-[(2-chlorophenoxy)methoxy]-2-(2,4-dichlorophenyl)ethenyl]imidazole |
| SMILES | Clc1ccc(C(=Cn2ccnc2)OCOc2ccccc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H13Cl3N2O2/c19-13-5-6-14(16(21)9-13)18(10-23-8-7-22-11-23)25-12-24-17-4-2-1-3-15(17)20/h1-11H,12H2 |
| InChIKey | LDOUJPLBBPKFDS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|