C15H17Cl2N3O3 — CID 70462656
1-[2-(2,4-dichlorophenyl)-3,3-dimethylbut-1-enyl]imidazole;nitric acid (PubChem CID 70462656) has the molecular formula C15H17Cl2N3O3 and a molecular weight of 358.23 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)-3,3-dimethylbut-1-enyl]imidazole;nitric acid.
| Compound Name | 1-[2-(2,4-dichlorophenyl)-3,3-dimethylbut-1-enyl]imidazole;nitric acid |
|---|---|
| PubChem CID | 70462656 |
| Molecular Formula | C15H17Cl2N3O3 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)-3,3-dimethylbut-1-enyl]imidazole;nitric acid |
| SMILES | CC(C)(C)C(=Cn1ccnc1)c1ccc(Cl)cc1Cl.O=[N+]([O-])O |
| InChI | InChI=1S/C15H16Cl2N2.HNO3/c1-15(2,3)13(9-19-7-6-18-10-19)12-5-4-11(16)8-14(12)17;2-1(3)4/h4-10H,1-3H3;(H,2,3,4) |
| InChIKey | PQFVKPKNNCCGJC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|