C18H11Cl3N2O2 — CID 4991198
[1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenyl] 4-chlorobenzoate (PubChem CID 4991198) has the molecular formula C18H11Cl3N2O2 and a molecular weight of 393.66 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenyl] 4-chlorobenzoate.
| Compound Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4991198 |
| Molecular Formula | C18H11Cl3N2O2 |
| Molecular Weight | 393.66 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-imidazol-1-ylethenyl] 4-chlorobenzoate |
| SMILES | O=C(OC(=Cn1ccnc1)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11Cl3N2O2/c19-13-3-1-12(2-4-13)18(24)25-17(10-23-8-7-22-11-23)15-6-5-14(20)9-16(15)21/h1-11H |
| InChIKey | NRGBALLBCBZJAP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.66 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|