C18H15Cl2N5O2 — CID 139894510
[1-(2,4-dichlorophenyl)-2-(tetrazol-1-yl)ethenyl] 4-(dimethylamino)benzoate (PubChem CID 139894510) has the molecular formula C18H15Cl2N5O2 and a molecular weight of 404.26 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)-2-(tetrazol-1-yl)ethenyl] 4-(dimethylamino)benzoate.
| Compound Name | [1-(2,4-dichlorophenyl)-2-(tetrazol-1-yl)ethenyl] 4-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 139894510 |
| Molecular Formula | C18H15Cl2N5O2 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | [1-(2,4-dichlorophenyl)-2-(tetrazol-1-yl)ethenyl] 4-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(C(=O)OC(=Cn2cnnn2)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H15Cl2N5O2/c1-24(2)14-6-3-12(4-7-14)18(26)27-17(10-25-11-21-22-23-25)15-8-5-13(19)9-16(15)20/h3-11H,1-2H3 |
| InChIKey | MZCGZGCOVBKOJZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|