C18H15Cl2N2O3- — CID 6985024
(E)-2-[(2,4-dichlorobenzoyl)amino]-3-[4-(dimethylamino)phenyl]prop-2-enoate (PubChem CID 6985024) has the molecular formula C18H15Cl2N2O3- and a molecular weight of 378.24 g/mol. Its IUPAC name is (E)-2-[(2,4-dichlorobenzoyl)amino]-3-[4-(dimethylamino)phenyl]prop-2-enoate.
| Compound Name | (E)-2-[(2,4-dichlorobenzoyl)amino]-3-[4-(dimethylamino)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 6985024 |
| Molecular Formula | C18H15Cl2N2O3- |
| Molecular Weight | 378.24 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | (E)-2-[(2,4-dichlorobenzoyl)amino]-3-[4-(dimethylamino)phenyl]prop-2-enoate |
| SMILES | CN(C)c1ccc(/C=C(/NC(=O)c2ccc(Cl)cc2Cl)C(=O)[O-])cc1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-22(2)13-6-3-11(4-7-13)9-16(18(24)25)21-17(23)14-8-5-12(19)10-15(14)20/h3-10H,1-2H3,(H,21,23)(H,24,25)/p-1/b16-9+ |
| InChIKey | KWOGVNJDORJLAR-CXUHLZMHSA-M |
| XLogP | 2.58 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|