C17H14Cl3NO — CID 67019924
2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one (PubChem CID 67019924) has the molecular formula C17H14Cl3NO and a molecular weight of 354.66 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one.
| Compound Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 67019924 |
| Molecular Formula | C17H14Cl3NO |
| Molecular Weight | 354.66 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,4-dichlorophenyl)-3-(dimethylamino)prop-2-en-1-one |
| SMILES | CN(C)C=C(C(=O)c1ccc(Cl)cc1Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl3NO/c1-21(2)10-15(11-3-5-12(18)6-4-11)17(22)14-8-7-13(19)9-16(14)20/h3-10H,1-2H3 |
| InChIKey | CXMXWBNIBNKGNU-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.66 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|