C18H20ClNO — CID 142838175
(E)-1-(4-chlorophenyl)-2-cyclohepta-1,5-dien-1-yl-3-(dimethylamino)prop-2-en-1-one (PubChem CID 142838175) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-2-cyclohepta-1,5-dien-1-yl-3-(dimethylamino)prop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-2-cyclohepta-1,5-dien-1-yl-3-(dimethylamino)prop-2-en-1-one |
|---|---|
| PubChem CID | 142838175 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-2-cyclohepta-1,5-dien-1-yl-3-(dimethylamino)prop-2-en-1-one |
| SMILES | CN(C)/C=C(/C(=O)c1ccc(Cl)cc1)C1=CCCC=CC1 |
| InChI | InChI=1S/C18H20ClNO/c1-20(2)13-17(14-7-5-3-4-6-8-14)18(21)15-9-11-16(19)12-10-15/h3,5,8-13H,4,6-7H2,1-2H3/b17-13+ |
| InChIKey | CKISYRQSICTGIJ-GHRIWEEISA-N |
| XLogP | 4.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|