C18H24ClNO2 — CID 67639179
1-(4-chlorophenyl)-2-(dimethylaminomethylidene)-4-ethyl-4-methylhexane-1,3-dione (PubChem CID 67639179) has the molecular formula C18H24ClNO2 and a molecular weight of 321.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(dimethylaminomethylidene)-4-ethyl-4-methylhexane-1,3-dione.
| Compound Name | 1-(4-chlorophenyl)-2-(dimethylaminomethylidene)-4-ethyl-4-methylhexane-1,3-dione |
|---|---|
| PubChem CID | 67639179 |
| Molecular Formula | C18H24ClNO2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(dimethylaminomethylidene)-4-ethyl-4-methylhexane-1,3-dione |
| SMILES | CCC(C)(CC)C(=O)C(=CN(C)C)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24ClNO2/c1-6-18(3,7-2)17(22)15(12-20(4)5)16(21)13-8-10-14(19)11-9-13/h8-12H,6-7H2,1-5H3 |
| InChIKey | ZEMIPRXATGOFOY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|