About (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone
(4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone (PubChem CID 138453692) has the molecular formula C15H15ClO
and a molecular weight of 246.74 g/mol. Its IUPAC name is (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone.
Molecular Properties
| Compound Name | (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone |
| PubChem CID | 138453692 |
| Molecular Formula | C15H15ClO |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone |
| SMILES | O=C(/C1=C/CC/C=C\CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClO/c16-14-10-8-13(9-11-14)15(17)12-6-4-2-1-3-5-7-12/h1-2,7-11H,3-6H2/b2-1-,12-7+ |
| InChIKey | JFJCFUXIGLMBCP-CTIYNGTBSA-N |
| XLogP | 4.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone?
The IUPAC name of (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone (CID 138453692) is (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone.
What is the SMILES notation for (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone?
The canonical SMILES for (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone is O=C(/C1=C/CC/C=C\CC1)c1ccc(Cl)cc1.
What is the InChIKey of (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone?
The InChIKey is JFJCFUXIGLMBCP-CTIYNGTBSA-N. The full InChI is InChI=1S/C15H15ClO/c16-14-10-8-13(9-11-14)15(17)12-6-4-2-1-3-5-7-12/h1-2,7-11H,3-6H2/b2-1-,12-7+.
What are the key properties of (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone?
(4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone has a molecular weight of 246.74 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)-[(1E,5Z)-cycloocta-1,5-dien-1-yl]methanone is sourced from PubChem (CID 138453692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).