C21H29NO — CID 90689450
3-(dimethylamino)-1,2-diphenylprop-2-en-1-one;ethane (PubChem CID 90689450) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is 3-(dimethylamino)-1,2-diphenylprop-2-en-1-one;ethane.
| Compound Name | 3-(dimethylamino)-1,2-diphenylprop-2-en-1-one;ethane |
|---|---|
| PubChem CID | 90689450 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 3-(dimethylamino)-1,2-diphenylprop-2-en-1-one;ethane |
| SMILES | CC.CC.CN(C)C=C(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17NO.2C2H6/c1-18(2)13-16(14-9-5-3-6-10-14)17(19)15-11-7-4-8-12-15;2*1-2/h3-13H,1-2H3;2*1-2H3 |
| InChIKey | CNGFFWNMDLOHMH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|