C19H21NO — CID 57169439
3-(dimethylamino)-1,2-bis(4-methylphenyl)prop-2-en-1-one (PubChem CID 57169439) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-(dimethylamino)-1,2-bis(4-methylphenyl)prop-2-en-1-one.
| Compound Name | 3-(dimethylamino)-1,2-bis(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57169439 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-(dimethylamino)-1,2-bis(4-methylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)C(=CN(C)C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H21NO/c1-14-5-9-16(10-6-14)18(13-20(3)4)19(21)17-11-7-15(2)8-12-17/h5-13H,1-4H3 |
| InChIKey | RGSPSKCXQAEIKP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|