C31H30N2O — CID 134200103
(E)-2-[4-(4-anilinophenyl)phenyl]-3-(dimethylamino)-1-(2,4-dimethylphenyl)prop-2-en-1-one (PubChem CID 134200103) has the molecular formula C31H30N2O and a molecular weight of 446.59 g/mol. Its IUPAC name is (E)-2-[4-(4-anilinophenyl)phenyl]-3-(dimethylamino)-1-(2,4-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-2-[4-(4-anilinophenyl)phenyl]-3-(dimethylamino)-1-(2,4-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 134200103 |
| Molecular Formula | C31H30N2O |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (E)-2-[4-(4-anilinophenyl)phenyl]-3-(dimethylamino)-1-(2,4-dimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C(=C/N(C)C)c2ccc(-c3ccc(Nc4ccccc4)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C31H30N2O/c1-22-10-19-29(23(2)20-22)31(34)30(21-33(3)4)26-13-11-24(12-14-26)25-15-17-28(18-16-25)32-27-8-6-5-7-9-27/h5-21,32H,1-4H3/b30-21+ |
| InChIKey | DGMUYNYNXQLXHE-MWAVMZGNSA-N |
| XLogP | 7.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|